CAS 120003-77-2

2,5-Pyridinedimethanol, 4-methoxy-3-methyl-, 2-acetate

Description:

2,5-Pyridinedimethanol, 4-methoxy-3-methyl-, 2-acetate, identified by CAS number 120003-77-2, is a chemical compound that features a pyridine ring substituted with multiple functional groups. This compound typically exhibits characteristics associated with both pyridine derivatives and alcohols, including potential solubility in polar solvents due to the presence of hydroxyl (-OH) groups. The methoxy (-OCH3) and methyl (-CH3) substituents can influence its reactivity and polarity, potentially enhancing its lipophilicity. The acetate functional group suggests that it may participate in esterification reactions and could be hydrolyzed under certain conditions. Additionally, the presence of multiple functional groups may impart biological activity, making it of interest in medicinal chemistry. Its structural complexity may also affect its physical properties, such as melting and boiling points, as well as its stability under various conditions. Overall, this compound's unique combination of functional groups positions it as a versatile molecule in both synthetic and applied chemistry contexts.

Formula: C₁₁H₁₅NO₄

InChI: InChI=1S/C11H15NO4/c1-7-10(6-16-8(2)14)12-4-9(5-13)11(7)15-3/h4,13H,5-6H2,1-3H3

InChI key: InChIKey=FNMCMPIACYABKB-UHFFFAOYSA-N

SMILES: O(C)C=1C(CO)=CN=C(COC(C)=O)C1C

Synonyms:

• 2,5-Pyridinedimethanol, 4-methoxy-3-methyl-, α2-acetate
• 2,5-Pyridinedimethanol, 4-methoxy-3-methyl-, 2-acetate
• [5-(Hydroxymethyl)-4-methoxy-3-methylpyridin-2-yl]methyl acetate
• 2-Acetoxymethyl-5-hydroxymethyl-4-methoxy-3-methylpyridine

2,5-Pyridinedimethanol, 4-methoxy-3-methyl-, 2-acetate

CAS: 120003-77-2

Formula: C₁₁H₁₅NO₄

Color and Shape: Liquid

Molecular weight: 225.2411

Ref: IN-DA000Q1V