CymitQuimica logo

CAS 120005-27-8

:

Benzenesulfinic acid, 4-hydroxy-, sodium salt (1:1)

Description:
Benzenesulfinic acid, 4-hydroxy-, sodium salt (1:1) is an organic compound characterized by the presence of a sulfinic acid group attached to a benzene ring that also features a hydroxyl group in the para position. This compound is typically a white to off-white solid and is soluble in water due to the ionic nature of the sodium salt. It exhibits properties typical of sulfinic acids, including the ability to act as a reducing agent and participate in various chemical reactions, such as nucleophilic substitutions. The hydroxyl group contributes to its reactivity and potential applications in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and other chemical products. Additionally, the presence of the sodium ion enhances its solubility and stability in aqueous solutions. Overall, this compound is of interest in both industrial and research settings due to its versatile chemical behavior and functional groups.
Formula:C6H6O3S·Na
InChI:InChI=1S/C6H6O3S.Na/c7-5-1-3-6(4-2-5)10(8)9;/h1-4,7H,(H,8,9);
InChI key:InChIKey=FHGBOUSMRRHRRW-UHFFFAOYSA-N
SMILES:S(=O)(O)C1=CC=C(O)C=C1.[Na]
Synonyms:
  • Benzenesulfinic acid, 4-hydroxy-, monosodium salt
  • Benzenesulfinic acid, 4-hydroxy-, sodium salt (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.