
CAS 12001-89-7
:Bis[(1,2,3,4,5,6-η)-(1-methylethyl)benzene]chromium
Description:
Bis[(1,2,3,4,5,6-η)-(1-methylethyl)benzene]chromium, with the CAS number 12001-89-7, is a coordination compound featuring chromium as the central metal atom coordinated to two ligands derived from isopropylbenzene (cumene). This compound is characterized by its unique structure, where the chromium atom is typically in a low oxidation state, allowing for interesting electronic properties and reactivity. The ligands contribute to the stability of the complex and influence its solubility and interaction with other chemical species. It is often studied in the context of organometallic chemistry due to its potential applications in catalysis and materials science. The compound may exhibit distinctive spectral properties, including UV-Vis and NMR, which can be utilized to investigate its electronic structure and bonding characteristics. Additionally, its reactivity can be influenced by the steric and electronic effects of the isopropylbenzene ligands, making it a subject of interest for further research in synthetic and applied chemistry.
Formula:C18H24Cr
InChI:InChI=1S/2C9H12.Cr/c2*1-8(2)9-6-4-3-5-7-9;/h2*3-8H,1-2H3;
InChI key:InChIKey=AWNBGWWVMCBBST-UHFFFAOYSA-N
SMILES:C(C)(C)C1=2[Cr]3456789%10%11(C=%12(C(C)C)[CH]3=[CH]4[CH]5=[CH]6[CH]7%12)[CH]1=[CH]8[CH]9=[CH]%10[CH]%112
Synonyms:- Chromium, bis(cumene)-
- Chromium, bis[(1,2,3,4,5,6-η)-(1-methylethyl)benzene]-
- Bis[(1,2,3,4,5,6-η)-(1-methylethyl)benzene]chromium
- Bis(cumene)chromium
- Benzene, (1-methylethyl)-, chromium complex
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
