CAS 120011-66-7
:toxin II, cyanobacterium
Description:
Toxin II, derived from cyanobacteria, is a potent neurotoxin primarily associated with certain species of blue-green algae. This compound is known for its ability to inhibit protein synthesis, leading to cellular damage and potential toxicity in aquatic organisms and humans. It typically exhibits high stability in various environmental conditions, which contributes to its persistence in water bodies. The molecular structure of Toxin II includes a cyclic peptide framework, which is characteristic of many cyanobacterial toxins. Its mechanism of action involves the disruption of ribosomal function, ultimately resulting in cell death. Due to its toxic nature, Toxin II poses significant risks to both aquatic ecosystems and human health, particularly through contaminated water sources or food chains. Monitoring and management of cyanobacterial blooms are crucial to mitigate the risks associated with this toxin. Overall, Toxin II exemplifies the complex interactions between environmental factors and biological toxins, highlighting the need for ongoing research and public health awareness regarding cyanobacterial toxins.
Formula:C48H72N10O12
InChI:InChI=1/C48H72N10O12/c1-26(2)22-36-45(65)57-37(47(68)69)25-39(59)53-34(16-13-21-51-48(49)50)44(64)54-33(18-17-27(3)23-28(4)38(70-9)24-32-14-11-10-12-15-32)29(5)41(61)55-35(46(66)67)19-20-40(60)58(8)31(7)43(63)52-30(6)42(62)56-36/h10-12,14-15,17-18,23,26,28-30,33-38H,7,13,16,19-22,24-25H2,1-6,8-9H3,(H,52,63)(H,53,59)(H,54,64)(H,55,61)(H,56,62)(H,57,65)(H,66,67)(H,68,69)(H4,49,50,51)/b18-17+,27-23+/t28-,29-,30+,33-,34-,35+,36-,37+,38-/m0/s1
Synonyms:- Toxin II, cyanobacterium
- Microcystin-[D-Asp3]-LR
- Cyanoginosin LA, 4-D-beta-aspartic acid-5-L-arginine-
- Microcystin LR, desMethyl ("Asp3-MCLR")
- toxin II, cyanobacterium
- (5R,8S,11R,15S,18S,19S,22R)-15-{3-[(diaminomethylidene)amino]propyl}-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dien-1-yl]-1,5,19-trimethyl-2-methylidene-8-(2-methylpropyl)-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptaazacyclopentacosane-11,22-dicarboxylic acid
- Cyclo-ala-leu-isoasp-arg-adda-isoglu-N-mdha
- (D-Asp3)microcystin LR
- (5R,8S,11R,15S,18S,19S,22R)-15-[3-(diaminomethylideneamino)propyl]-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-1,5,19-trimethyl-2-methylidene-8-(2-methylpropyl)-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptazacyclopentacosane-11,22-dicarboxylic acid
- Cyclo[2,3-didehydro-N-methylalanyl-D-alanyl-L-leucyl-D-β-aspartyl-L-arginyl-(2S,3S,4E,6E,8S,9S)-3-amino-9-methoxy-2,6,8-trimethyl-10-phenyl-4,6-decadienoyl-D-γ-glutamyl]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

