CAS 120013-75-4
:1-Benzyl-4-[(5-benzyloxy-6-methoxy-1-indanone)-2-ylidenyl]methylpiperidine
Description:
1-Benzyl-4-[(5-benzyloxy-6-methoxy-1-indanone)-2-ylidenyl]methylpiperidine, with the CAS number 120013-75-4, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring and multiple aromatic substituents. This compound features a benzyl group and an indanone moiety, which contribute to its potential biological activity. The presence of methoxy and benzyloxy groups suggests that it may exhibit interesting electronic properties and solubility characteristics. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry. The structural diversity provided by the various functional groups may influence its interactions with biological targets, making it a candidate for further research in drug development. Additionally, the compound's stability, reactivity, and solubility in various solvents would be important factors to consider in experimental applications. Overall, this compound exemplifies the complexity often found in organic molecules designed for specific biological functions.
Formula:C30H31NO3
InChI:InChI=1/C30H31NO3/c1-33-28-19-27-25(18-29(28)34-21-24-10-6-3-7-11-24)17-26(30(27)32)16-22-12-14-31(15-13-22)20-23-8-4-2-5-9-23/h2-11,16,18-19,22H,12-15,17,20-21H2,1H3/b26-16-
SMILES:COc1cc2c(C/C(=C/C3CCN(CC3)Cc3ccccc3)/C2=O)cc1OCc1ccccc1
Synonyms:- (2Z)-5-(benzyloxy)-2-[(1-benzylpiperidin-4-yl)methylidene]-6-methoxy-2,3-dihydro-1H-inden-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-Benzyl-4-[(5-benzyloxy-6-methoxy-1-indanone)-2-ylidenyl]methylpiperidine
CAS:Formula:C30H31NO3Color and Shape:SolidMolecular weight:453.5721-Benzyl-4-[(5-benzyloxy-6-methoxy-1-indanone)-2-ylidenyl]methylpiperidine
CAS:Controlled ProductApplications A benzylalkylpiperidine derivative as acetylcholinesterase inhibitor.
References Xu, A., et al.: Neuroscience Lett., 331, 33 (2002),Formula:C30H31NO3Color and Shape:NeatMolecular weight:453.57

