CymitQuimica logo

CAS 120018-43-1

:

2-AZIDO-3,8-DIMETHYLIMIDAZO[4,5-F]QUINOXALINE

Description:
2-Azido-3,8-dimethylimidazo[4,5-f]quinoxaline is a heterocyclic compound characterized by the presence of both azido and dimethyl groups within its imidazoquinoxaline framework. This compound features a fused bicyclic structure that incorporates nitrogen atoms, contributing to its unique chemical properties. The azido group (-N3) is known for its reactivity, particularly in click chemistry and as a potential precursor for various nitrogen-containing compounds. The dimethyl substitutions at the 3 and 8 positions enhance the compound's lipophilicity and may influence its biological activity. Typically, compounds of this class are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as intermediates in organic synthesis. Additionally, the presence of multiple nitrogen atoms in the structure may impart interesting electronic properties, making it a subject of interest in materials science and coordination chemistry. Safety precautions should be taken when handling this compound due to the potential hazards associated with azido groups, which can be explosive under certain conditions.
Formula:C11H9N7
InChI:InChI=1/C11H9N7/c1-6-5-13-7-3-4-8-10(9(7)14-6)15-11(16-17-12)18(8)2/h3-5H,1-2H3
SMILES:Cc1cnc2ccc3c(c2n1)nc(N=[N+]=[NH-])n3C
Synonyms:
  • Azido-Meiqx
  • 2-azido-3,8-dimethyl-3H-imidazo[4,5-f]quinoxaline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.