CAS 120020-26-0
:β-Artelinic acid
Description:
β-Artelinic acid is a chemical compound that belongs to the class of organic acids, specifically a derivative of artemisinin. It is characterized by its unique structure, which includes a bicyclic lactone moiety, contributing to its biological activity. This compound has garnered interest in medicinal chemistry due to its potential antimalarial properties, as it is related to artemisinin, a well-known antimalarial agent derived from the sweet wormwood plant. β-Artelinic acid exhibits moderate solubility in organic solvents and is typically stable under standard laboratory conditions. Its reactivity can be influenced by the presence of functional groups, making it a candidate for further chemical modifications to enhance its pharmacological profile. Research into β-Artelinic acid continues to explore its efficacy and mechanisms of action, particularly in the context of combating malaria and other parasitic infections. As with many compounds in this class, safety and toxicity assessments are crucial for its potential therapeutic applications.
Formula:C23H30O7
InChI:InChI=1S/C23H30O7/c1-13-4-9-18-14(2)20(26-12-15-5-7-16(8-6-15)19(24)25)27-21-23(18)17(13)10-11-22(3,28-21)29-30-23/h5-8,13-14,17-18,20-21H,4,9-12H2,1-3H3,(H,24,25)/t13-,14-,17+,18+,20+,21-,22-,23-/m1/s1
InChI key:InChIKey=UVNHKOOJXSALHN-ILQPJIFQSA-N
SMILES:C[C@@H]1[C@]2([C@]34[C@](O[C@@H]1OCC5=CC=C(C(O)=O)C=C5)(O[C@](C)(OO3)CC[C@]4([C@H](C)CC2)[H])[H])[H]
Synonyms:- Artelinic acid
- Benzoic acid, 4-[[[(3R,5aS,6R,8aS,9R,10S,12R,12aR)-decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-yl]oxy]methyl]-
- Benzoic acid, 4-[[(decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-yl)oxy]methyl]-, [3R-(3α,5aβ,6β,8aβ,9α,10α,12β,12aR*)]-
- 4-[[[(3R,5aS,6R,8aS,9R,10S,12R,12aR)-Decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-yl]oxy]methyl]benzoic acid
- 3,12-Epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin, benzoic acid deriv.
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Artelinic acid
CAS:<p>Artelinic acid is a synthetic antimalarial agent, which is derived from artemisinin, a natural compound sourced from the sweet wormwood plant (Artemisia annua). The mode of action of Artelinic acid involves the generation of free radicals within the Plasmodium parasite, leading to oxidative stress and damage to the parasite’s cellular components, ultimately resulting in parasite death. This mechanism is particularly effective against Plasmodium species, including those strains resistant to other antimalarial drugs.</p>Formula:C23H30O7Purity:Min. 95%Molecular weight:418.5 g/molArtelinic acid
CAS:Artelinic acid is an artemisinin analog with antimalarial activity and is used for the treatment of multi-drug resistant strains of Plasmodium falciparum.Formula:C23H30O7Purity:97.49% - 97.69%Color and Shape:SolidMolecular weight:418.48Ref: TM-T10378
1mg94.00€5mg222.00€10mg356.00€25mg670.00€50mg1,044.00€100mg1,485.00€200mg2,008.00€1mL*10mM (DMSO)286.00€


