CymitQuimica logo

CAS 1200219-16-4

:

5-Chloro-1,2-benzisoxazole-3-methanol

Description:
5-Chloro-1,2-benzisoxazole-3-methanol is a chemical compound characterized by its unique structure, which includes a benzisoxazole ring system and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The presence of the chlorine atom introduces electronegative characteristics, which can influence the compound's solubility and interaction with other molecules. As a methanol derivative, it may also exhibit polar characteristics, enhancing its solubility in polar solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the benzisoxazole moiety, which is known for its biological activity. Additionally, the compound may be of interest in materials science and organic synthesis. However, specific physical properties such as melting point, boiling point, and spectral data would need to be referenced from experimental studies or databases for precise applications and handling guidelines.
Formula:C8H6ClNO2
InChI:InChI=1S/C8H6ClNO2/c9-5-1-2-8-6(3-5)7(4-11)10-12-8/h1-3,11H,4H2
InChI key:InChIKey=RFCQEZKNTFUCOH-UHFFFAOYSA-N
SMILES:C(O)C=1C=2C(ON1)=CC=C(Cl)C2
Synonyms:
  • 5-Chloro-1,2-benzisoxazole-3-methanol
  • (5-Chloro-1,2-benzoxazol-3-yl)methanol
  • 1,2-Benzisoxazole-3-methanol, 5-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.