CymitQuimica logo

CAS 120022-63-1

:

2,5-DIFLUOROBENZENESULFONAMIDE

Description:
2,5-Difluorobenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a difluorobenzene ring. The compound features two fluorine atoms positioned at the 2 and 5 positions of the benzene ring, which significantly influences its chemical properties, including its reactivity and polarity. The sulfonamide group contributes to its potential as a pharmacological agent, as sulfonamides are known for their antibacterial properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide group. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry and material science. Additionally, the presence of fluorine atoms can enhance metabolic stability and bioavailability in drug development. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H5F2NO2S
InChI:InChI=1/C6H5F2NO2S/c7-4-1-2-5(8)6(3-4)12(9,10)11/h1-3H,(H2,9,10,11)
InChI key:OLMFEUWXDKZGOO-UHFFFAOYSA-N
SMILES:c1cc(c(cc1F)S(=O)(=O)N)F
Synonyms:
  • Buttpark 21\07-14
  • 2,5-Difluorobenzenesulphonamide
  • Benzenesulfonamide, 2,5-difluoro- (9CI)
Found 5 products.