CAS 120033-84-3
:dimethyl-1,1,1-D3-amine hydrochloride
Description:
Dimethyl-1,1,1-D3-amine hydrochloride, with the CAS number 120033-84-3, is a deuterated derivative of dimethylamine, which is an organic compound characterized by the presence of two methyl groups attached to a nitrogen atom. The "D3" in its name indicates that it contains three deuterium atoms, which are isotopes of hydrogen, enhancing its utility in various research applications, particularly in NMR spectroscopy and tracer studies. As a hydrochloride salt, it is typically encountered in a solid form, which is soluble in water and other polar solvents. This compound is often used in the synthesis of pharmaceuticals and in chemical research due to its ability to participate in nucleophilic reactions. Its deuterated nature allows for the tracking of molecular pathways and interactions in biological systems. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken during use.
Formula:C2H5D3ClN
InChI:InChI=1/C2H7N.ClH/c1-3-2;/h3H,1-2H3;1H/i1D3;
SMILES:C(NC)([2H])([2H])[2H].Cl
Synonyms:- N-methyl(2H3)methanamine hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Dimethyl-1,1,1-d3-amine HCl
CAS:Formula:CH3(CD3)NHHClPurity:98 atom % DColor and Shape:White SolidMolecular weight:84.05336Dimethylamine-d3 Hydrochloride
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications Isotope labelled Dimethylamine hydrochloride is a precursor to several industrially significant compounds.<br>References Burton, P., et al.: Biochem. J., 432, 575 (2010); Shim, K.S., et al.: DNA Repair., 5, 718 (2006); Robacker, D.C., et al.: J. Chem. Ecol., 23, 1263 (1997);<br></p>Formula:C22H3H4N·ClHColor and Shape:NeatMolecular weight:84.56


