CAS 120042-13-9
:3-Azido-2-methylalanine
Description:
3-Azido-2-methylalanine is an amino acid derivative characterized by the presence of an azido group (-N3) at the 3-position and a methyl group at the 2-position of the alanine backbone. This compound is notable for its potential applications in bioconjugation and click chemistry, owing to the reactivity of the azido group, which can participate in various chemical reactions, including the well-known azide-alkyne cycloaddition. The presence of the methyl group influences the steric and electronic properties of the molecule, potentially affecting its interactions with biological systems. As an amino acid derivative, it retains the basic structure of amino acids, including an amino group (-NH2), a carboxylic acid group (-COOH), and a side chain that contributes to its unique properties. The compound is typically synthesized through organic chemistry methods and may be used in research settings, particularly in the fields of medicinal chemistry and materials science. Safety and handling precautions should be observed due to the reactive nature of the azido group.
Formula:C4H8N4O2
InChI:InChI=1S/C4H8N4O2/c1-4(5,3(9)10)2-7-8-6/h2,5H2,1H3,(H,9,10)
InChI key:InChIKey=WDJUCIRNDRCXTL-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CN=[N+]=[N-])(C)N
Synonyms:- 2-Amino-3-azido-2-methylpropanoic acid
- 3-Azido-2-methylalanine
- Alanine, 3-azido-2-methyl-
- DL-Alanine, 3-azido-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
