CAS 120042-14-0
:2(S)-Amino-4-azido-butanoic Acid
Description:
2(S)-Amino-4-azido-butanoic acid, also known by its CAS number 120042-14-0, is an amino acid derivative characterized by the presence of an azido group (-N3) at the 4-position of the butanoic acid chain. This compound features a chiral center at the second carbon, which contributes to its stereochemistry, specifically the S configuration. The azido group is notable for its reactivity, particularly in click chemistry applications, making this compound valuable in bioconjugation and labeling studies. The presence of both amino and carboxylic acid functional groups allows it to participate in various chemical reactions, including peptide synthesis and modifications. Its solubility in polar solvents, such as water and alcohols, is typical for amino acids, facilitating its use in biological and chemical research. Additionally, the compound's unique structure may impart specific biological activities, although detailed studies would be necessary to elucidate its full potential in pharmacological applications. Overall, 2(S)-Amino-4-azido-butanoic acid serves as an important building block in synthetic chemistry and biochemistry.
Formula:C4H8N4O2
InChI:InChI=1/C4H8N4O2/c5-3(4(9)10)1-2-7-8-6/h3H,1-2,5H2,(H,9,10)/t3-/m0/s1
SMILES:C(CN=[N+]=[NH-])[C@@H](C(=O)O)N
Synonyms:- (2S)-2-Amino-4-azido-butanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
L-Azidohomoalanine
CAS:Formula:C4H8N4O2Purity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:144.13H-γ-azido-Abu-OH
CAS:The methionine isostere γ-azidohomoalanine is fed to bacteria for obtaining “clickable” proteins by recombinant synthesis. Additionally, the azido moiety can serve as a probe for studying protein conformations by IR-spectroscopy.Formula:C4H8N4O2Purity:> 99%Color and Shape:White PowderMolecular weight:144.13(2S)-2-amino-4-azidobutanoic acid
CAS:Formula:C4H8N4O2Purity:98.0%Color and Shape:SolidMolecular weight:144.1319L-Azidohomoalanine
CAS:L-Azidohomoalanine, an alkyl chain-derived PROTAC linker, is utilized in the synthesis of PROTACs[1].Formula:C4H8N4O2Purity:98%Color and Shape:Off-White SolidMolecular weight:144.132(S)-Amino-4-azido-butanoic Acid
CAS:Controlled Product<p>Applications 2(S)-Amino-4-azido-butanoic Acid is a novel mutagenic amino acid.<br>References Owais, W.M., et al.: Mutation Res., 118, 229 (1983); Mangold, J.B., et al.: The Pharmacologist, 27, 296 (1985);<br></p>Formula:C4H8N4O2Color and Shape:NeatMolecular weight:144.13





