CAS 1200443-26-0

4-Methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneacetic acid

Description:

4-Methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneacetic acid is an organic compound characterized by its complex structure, which includes a methoxy group and a dioxaborolane moiety. This compound features a benzene ring substituted with both a methoxy group and a benzeneacetic acid functional group, contributing to its potential applications in medicinal chemistry and organic synthesis. The presence of the dioxaborolane group suggests that it may participate in boron chemistry, which is often utilized in cross-coupling reactions and as a building block in the synthesis of various organic compounds. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for further research in drug development or material science. Additionally, the presence of the boron atom may impart unique properties, such as the ability to form complexes with other molecules, enhancing its utility in various chemical applications. Overall, this compound exemplifies the intricate interplay of functional groups in organic chemistry.

Formula: C₁₅H₂₁BO₅

InChI: InChI=1S/C15H21BO5/c1-14(2)15(3,4)21-16(20-14)11-8-10(9-13(17)18)6-7-12(11)19-5/h6-8H,9H2,1-5H3,(H,17,18)

InChI key: InChIKey=WWERXHFFDPSMAP-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(CC(O)=O)C=C1)B2OC(C)(C)C(C)(C)O2

Synonyms:

• 2-(4-Methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetic acid
• Benzeneacetic acid, 4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
• 4-Methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneacetic acid