CAS 1200497-73-9

4-(1,1-Dimethylethyl) 6,7-dihydropyrazolo[1,5-a]pyrimidine-2,4(5H)-dicarboxylate

Description:

4-(1,1-Dimethylethyl) 6,7-dihydropyrazolo[1,5-a]pyrimidine-2,4(5H)-dicarboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyrimidine framework. This compound features two carboxylate functional groups, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity, which may influence its biological activity and solubility properties. The dihydropyrazolo moiety suggests potential reactivity and interactions with biological targets, making it of interest in drug development. Its CAS number, 1200497-73-9, allows for precise identification in chemical databases. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation into its applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₂H₁₇N₃O₄

InChI: InChI=1S/C12H17N3O4/c1-12(2,3)19-11(18)14-5-4-6-15-9(14)7-8(13-15)10(16)17/h7H,4-6H2,1-3H3,(H,16,17)

InChI key: InChIKey=FJPKYMPZOKJEBL-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C=2N(N=C(C(O)=O)C2)CCC1

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-2,4(5H)-dicarboxylic acid, 6,7-dihydro-, 4-(1,1-dimethylethyl) ester
• 4-(1,1-Dimethylethyl) 6,7-dihydropyrazolo[1,5-a]pyrimidine-2,4(5H)-dicarboxylate

4-[(tert-Butoxy)carbonyl]-4H,5H,6H,7H-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

CAS: 1200497-73-9

Versatile small molecule scaffold

Formula: C₁₂H₁₇N₃O₄

Purity: Min. 95%

Molecular weight: 267.28 g/mol

Ref: 3D-AYB49773