CAS 120079-43-8

Thieno[3′,2′:4,5]pyrimido[1,2-a]azepin-11(5H)-one, 6,7,8,9-tetrahydro-

Description:

Thieno[3′,2′:4,5]pyrimido[1,2-a]azepin-11(5H)-one, 6,7,8,9-tetrahydro- is a heterocyclic compound characterized by its complex fused ring structure, which includes a thieno and pyrimidine moiety along with an azepine ring. This compound typically exhibits properties associated with its nitrogen and sulfur-containing framework, such as potential biological activity, making it of interest in medicinal chemistry. The presence of multiple rings contributes to its rigidity and may influence its interaction with biological targets. The tetrahydro configuration indicates that the compound has been partially saturated, which can affect its solubility and reactivity. Additionally, the specific arrangement of functional groups can lead to unique pharmacological properties, making it a candidate for further research in drug development. Its CAS number, 120079-43-8, allows for easy identification in chemical databases, facilitating studies related to its synthesis, characterization, and potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₁H₁₂N₂OS

InChI: InChI=1S/C11H12N2OS/c14-11-10-8(5-7-15-10)12-9-4-2-1-3-6-13(9)11/h5,7H,1-4,6H2

InChI key: InChIKey=AMQFTDAJYBYUIG-UHFFFAOYSA-N

SMILES: O=C1C2=C(N=C3N1CCCCC3)C=CS2

Synonyms:

• Thieno[3′,2′:4,5]pyrimido[1,2-a]azepin-11(5H)-one, 6,7,8,9-tetrahydro-