CymitQuimica logo

CAS 120079-90-5

:

2,3-Dihydro-3-(2-methyl-2-propen-1-yl)-2-thioxothieno[3,2-d]pyrimidin-4(1H)-one

Description:
2,3-Dihydro-3-(2-methyl-2-propen-1-yl)-2-thioxothieno[3,2-d]pyrimidin-4(1H)-one, with the CAS number 120079-90-5, is a heterocyclic compound characterized by its unique thieno-pyrimidine structure. This compound features a thioxo group, which contributes to its reactivity and potential biological activity. The presence of a 2-methyl-2-propen-1-yl substituent indicates that it may exhibit alkene-like properties, potentially influencing its reactivity and interactions with other molecules. The thieno and pyrimidine rings provide a framework that can participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of pharmaceuticals, particularly in targeting specific biological pathways. Additionally, the compound's properties, such as solubility, stability, and reactivity, would be influenced by the functional groups present, making it a candidate for further research in organic synthesis and pharmacology.
Formula:C10H10N2OS2
InChI:InChI=1S/C10H10N2OS2/c1-6(2)5-12-9(13)8-7(3-4-15-8)11-10(12)14/h3-4H,1,5H2,2H3,(H,11,14)
InChI key:InChIKey=ZECFXJZPYUXXDN-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(=S)N1CC(C)=C)C=CS2
Synonyms:
  • Thieno[3,2-d]pyrimidin-4(1H)-one, 2,3-dihydro-3-(2-methyl-2-propenyl)-2-thioxo-
  • 2,3-Dihydro-3-(2-methyl-2-propen-1-yl)-2-thioxothieno[3,2-d]pyrimidin-4(1H)-one
  • Thieno[3,2-d]pyrimidin-4(1H)-one, 2,3-dihydro-3-(2-methyl-2-propen-1-yl)-2-thioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.