CymitQuimica logo

CAS 120081-44-9

:

5-[2-(Acetyloxy)ethyl]-2-pyrrolidinone

Description:
5-[2-(Acetyloxy)ethyl]-2-pyrrolidinone, with the CAS number 120081-44-9, is a chemical compound characterized by its pyrrolidinone structure, which features a five-membered lactam ring. This compound contains an acetyloxy group, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the acetyloxy group suggests that it may participate in esterification reactions, making it useful in the synthesis of various derivatives. Additionally, the pyrrolidinone moiety is known for its ability to act as a solvent and a building block in pharmaceuticals and agrochemicals. The compound's solubility in polar solvents indicates its potential utility in various chemical processes. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during its use. Overall, 5-[2-(Acetyloxy)ethyl]-2-pyrrolidinone is a versatile compound with applications in synthetic chemistry and material science.
Formula:C8H13NO3
InChI:InChI=1S/C8H13NO3/c1-6(10)12-5-4-7-2-3-8(11)9-7/h7H,2-5H2,1H3,(H,9,11)
InChI key:InChIKey=QBJIWDVWEGCYPB-UHFFFAOYSA-N
SMILES:C(COC(C)=O)C1CCC(=O)N1
Synonyms:
  • 2-(5-Oxopyrrolidin-2-yl)ethyl acetate
  • 5-[2-(Acetyloxy)ethyl]-2-pyrrolidinone
  • 2-Pyrrolidinone, 5-[2-(acetyloxy)ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.