CAS 120095-20-7
:Benzeneacetic acid, 2-amino-5-chloro-α-oxo-, potassium salt (1:1)
Description:
Benzeneacetic acid, 2-amino-5-chloro-α-oxo-, potassium salt (1:1) is a chemical compound characterized by its structure, which includes a benzene ring, an acetic acid moiety, an amino group, and a chloro substituent. The presence of the potassium salt form indicates that it is a stable ionic compound, enhancing its solubility in water. This compound typically exhibits properties associated with both organic acids and amino acids, such as potential biological activity and reactivity due to the functional groups present. The chloro substituent may influence its reactivity and interaction with biological systems. As a potassium salt, it may also serve as a source of potassium ions in various applications, including pharmaceuticals and agricultural products. The compound's unique combination of functional groups suggests potential uses in medicinal chemistry, particularly in the development of therapeutic agents. However, specific applications and biological activities would depend on further empirical studies and characterization.
Formula:C8H6ClNO3·K
InChI:InChI=1S/C8H6ClNO3.K/c9-4-1-2-6(10)5(3-4)7(11)8(12)13;/h1-3H,10H2,(H,12,13);
InChI key:InChIKey=FXRGQCOLMBSPKB-UHFFFAOYSA-N
SMILES:C(C(O)=O)(=O)C1=C(N)C=CC(Cl)=C1.[K]
Synonyms:- Benzeneacetic acid, 2-amino-5-chloro-α-oxo-, monopotassium salt
- Benzeneacetic acid, 2-amino-5-chloro-α-oxo-, potassium salt (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
