CAS 1201-07-6

8-Bromo-4-chloro-2-methylquinoline

Description:

8-Bromo-4-chloro-2-methylquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 8 and 4 positions, respectively, along with a methyl group at the 2 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The halogen substituents can enhance the compound's reactivity and influence its interactions with biological targets. Additionally, 8-Bromo-4-chloro-2-methylquinoline may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₁₀H₇BrClN

InChI: InChI=1/C10H7BrClN/c1-6-5-9(12)7-3-2-4-8(11)10(7)13-6/h2-5H,1H3

SMILES: Cc1cc(c2cccc(c2n1)Br)Cl

Quinoline, 8-bromo-4-chloro-2-methyl-

CAS: 1201-07-6

Formula: C₁₀H₇BrClN

Purity: 97%

Color and Shape: Solid

Molecular weight: 256.5263

Ref: IN-DA000QBA

8-Bromo-4-chloro-2-methylquinoline

CAS: 1201-07-6

8-Bromo-4-chloro-2-methylquinoline

Formula: C₁₀H₇BrClN

Purity: 98%

Color and Shape: light brown powder

Molecular weight: 256.52628g/mol

Ref: 54-OR307816

8-Bromo-4-chloro-2-methylquinoline

CAS: 1201-07-6

Formula: C₁₀H₇BrClN

Purity: 98%

Molecular weight: 256.53

Ref: 10-F219299