CymitQuimica logo

CAS 1201-07-6

:

8-Bromo-4-chloro-2-methylquinoline

Description:
8-Bromo-4-chloro-2-methylquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 8 and 4 positions, respectively, along with a methyl group at the 2 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The halogen substituents can enhance the compound's reactivity and influence its interactions with biological targets. Additionally, 8-Bromo-4-chloro-2-methylquinoline may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.
Formula:C10H7BrClN
InChI:InChI=1/C10H7BrClN/c1-6-5-9(12)7-3-2-4-8(11)10(7)13-6/h2-5H,1H3
InChI key:SDVHWORPDUOWDV-UHFFFAOYSA-N
SMILES:Cc1cc(c2cccc(c2n1)Br)Cl
Found 4 products.