CAS 1201-31-6
:2,3,4,5-Tetrafluorobenzoic acid
Description:
2,3,4,5-Tetrafluorobenzoic acid is a fluorinated aromatic carboxylic acid characterized by the presence of four fluorine atoms attached to a benzoic acid structure. The fluorine substituents are located at the 2, 3, 4, and 5 positions on the benzene ring, which significantly influences the compound's chemical properties, including its acidity and reactivity. This compound is typically a white crystalline solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid functional group. The fluorine atoms enhance the compound's stability and can affect its interactions with biological systems, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the presence of multiple electronegative fluorine atoms can lead to unique electronic properties, influencing its behavior in chemical reactions. Safety data indicate that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C7H2F4O2
InChI:InChI=1S/C7H2F4O2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1H,(H,12,13)
InChI key:InChIKey=SFKRXQKJTIYUAG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C(F)=C(F)C(F)=C1
Synonyms:- 2,3,4,5-Tetrafluorobenzoate
- 2,3,4,5-Tetrafluorobezoic acid
- 3,4,5,6-Tetrafluorobenzoic acid
- Benzoic acid, 2,3,4,5-tetrafluoro-
- Bis(3-Methylimidazol-3-Ium-1-Yl)Methanone
- NSC 168728
- Trifluoromethanesulfonate
- 2,3,4,5-Tetrafluorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
2,3,4,5-Tetrafluorobenzoic Acid
CAS:Formula:C7H2F4O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Gray to Red powder to crystalMolecular weight:194.08Benzoic acid, 2,3,4,5-tetrafluoro-
CAS:Formula:C7H2F4O2Purity:98%Color and Shape:SolidMolecular weight:194.08322,3,4,5-Tetrafluorobenzoic acid
CAS:2,3,4,5-Tetrafluorobenzoic acidFormula:C7H2F4O2Purity:99%Color and Shape: white solidMolecular weight:194.08g/mol2,3,4,5-Tetrafluorobenzoic acid
CAS:Formula:C7H2F4O2Purity:99.0%Color and Shape:Solid, PowderMolecular weight:194.0852,3,4,5-Tetrafluorobenzoic acid
CAS:Controlled Product<p>Applications 2,3,4,5-Tetrafluorobenzoic Acid is used in the synthesis of diterpenoid analogs as antitumor compounds. Also used in the synthesis of novel quinoline lactones.<br>References Li, D. et al.: Eur. J. Med. Chem., 64, 215 (2013); Zheng, H. et al.: Lett. Org. Chem., 10, 252 (2013);<br></p>Formula:C7H2F4O2Color and Shape:NeatMolecular weight:194.082,3,4,5-Tetrafluorobenzoic acid
CAS:<p>Tetrafluorobenzoic acid is a synthetic chemical that is used in the synthesis of antimicrobial agents. Tetrafluorobenzoic acid has been shown to bind to the hydroxyl group of 2,3,4,5-tetrafluorobenzoyl chloride and form a covalent bond. The reaction solution was analyzed using crystallography and showed that there are no intermolecular hydrogen bonds between tetrafluorobenzoic acid molecules. The crystal structure was determined by X-ray diffraction analysis and found that the intramolecular hydrogen bonding may be responsible for the anti-microbial activity of this substance.</p>Formula:C7H2F4O2Molecular weight:194.08 g/mol







