CAS 1201-91-8
:4-(n-Methyl-n-hydroxyethyl)amino benzaldehyde
Description:
4-(n-Methyl-n-hydroxyethyl)amino benzaldehyde, with the CAS number 1201-91-8, is an organic compound characterized by its aromatic structure, featuring a benzaldehyde group attached to an amino group that is further substituted with a hydroxyethyl and a methyl group. This compound typically appears as a solid or liquid, depending on its specific form and purity. It is known for its potential applications in various fields, including pharmaceuticals and dye manufacturing, due to its reactivity and ability to participate in various chemical reactions, such as condensation and substitution. The presence of both the aldehyde and amino functional groups allows for diverse chemical behavior, making it a valuable intermediate in organic synthesis. Additionally, the hydroxyethyl group contributes to its solubility in polar solvents, enhancing its utility in different chemical environments. Safety data should be consulted for handling, as compounds of this nature may pose health risks if not managed properly.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-11(6-7-12)10-4-2-9(8-13)3-5-10/h2-5,8,12H,6-7H2,1H3
SMILES:CN(CCO)c1ccc(cc1)C=O
Synonyms:- N-Hydroxyethyl-N-Methyl-4-Aminobenzaldehyde
- N-methyl-N-hydroxyethyl-4-amino benzaldehyde
- 4-[(2-Hydroxyethyl)(Methyl)Amino]Benzaldehyde
- N-Methyl-N-(2-hydroxyethyl)-4-aminobenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzaldehyde, 4-[(2-hydroxyethyl)methylamino]-
CAS:Formula:C10H13NO2Purity:97%Color and Shape:SolidMolecular weight:179.2157N-Methyl-N-(2-hydroxyethyl)-4-aminobenzaldehyde
CAS:N-Methyl-N-(2-hydroxyethyl)-4-aminobenzaldehydePurity:97%Color and Shape:SolidMolecular weight:179.22g/mol4-[(2-Hydroxyethyl)(methyl)amino]benzaldehyde
CAS:Formula:C10H13NO2Purity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:179.224-((2-Hydroxyethyl)(methyl)amino)benzaldehyde
CAS:Formula:C10H13NO2Purity:97%Molecular weight:179.2194-[(2-Hydroxyethyl)methylamino]benzaldehyde
CAS:Controlled ProductApplications 4-[(2-hydroxyethyl)methylamino]-Benzaldehyde is used in the synthesis crosslinkable tricyanopyrroline polymeric electro-optic materials. 4-[(2-hydroxyethyl)methylamino]-Benzaldehyde is also used in the chemical process when synthesizing polymethacrylates.
References Wang, L. et al.: Polym. Sci. Ser. B, 54, 297 (2012); Rondou, P. et al.: Makromol. Chem., 193, 3045 (1992); Liu, J. et al.: J. Mat. Sci. Mat. Elect., 23, 1182 (2012);Formula:C10H13NO2Color and Shape:NeatMolecular weight:179.22N-Methyl-N-hydroxyethyl-4-aminobenzaldehyde
CAS:N-Methyl-N-hydroxyethyl-4-aminobenzaldehyde (NHABA) is a bathochromic molecule that absorbs light at wavelengths of 400 to 500 nm. It is reactive and reacts with metal cations to form chromophores. NHABA has been shown to be a fluorescent probe for the detection of tyrosinase and autophagy in human serum. It also has inhibitory properties against tyrosinase, which may be due to its ability to inhibit the formation of melanin. NHABA is used as an analytical chemistry reagent for the determination of ammonia, nitrite, and nitrate ions in water samples. This molecule can also be used as a chemosensor for the detection of phenolic compounds in water samples.Formula:C10H13NO2Purity:Min. 95%Molecular weight:179.22 g/mol





