CymitQuimica logo

CAS 1201-91-8

:

4-(n-Methyl-n-hydroxyethyl)amino benzaldehyde

Description:
4-(n-Methyl-n-hydroxyethyl)amino benzaldehyde, with the CAS number 1201-91-8, is an organic compound characterized by its aromatic structure, featuring a benzaldehyde group attached to an amino group that is further substituted with a hydroxyethyl and a methyl group. This compound typically appears as a solid or liquid, depending on its specific form and purity. It is known for its potential applications in various fields, including pharmaceuticals and dye manufacturing, due to its reactivity and ability to participate in various chemical reactions, such as condensation and substitution. The presence of both the aldehyde and amino functional groups allows for diverse chemical behavior, making it a valuable intermediate in organic synthesis. Additionally, the hydroxyethyl group contributes to its solubility in polar solvents, enhancing its utility in different chemical environments. Safety data should be consulted for handling, as compounds of this nature may pose health risks if not managed properly.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-11(6-7-12)10-4-2-9(8-13)3-5-10/h2-5,8,12H,6-7H2,1H3
InChI key:JOCUIVLSLBBESN-UHFFFAOYSA-N
SMILES:CN(CCO)c1ccc(cc1)C=O
Synonyms:
  • N-Hydroxyethyl-N-Methyl-4-Aminobenzaldehyde
  • N-methyl-N-hydroxyethyl-4-amino benzaldehyde
  • 4-[(2-Hydroxyethyl)(Methyl)Amino]Benzaldehyde
  • N-Methyl-N-(2-hydroxyethyl)-4-aminobenzaldehyde
Found 7 products.