CymitQuimica logo

CAS 1201080-20-7

:

Methyl 3-(acetylamino)-4-ethoxybenzoate

Description:
Methyl 3-(acetylamino)-4-ethoxybenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a methyl ester group, an ethoxy substituent, and an acetylamino group, contributing to its overall structure and reactivity. The presence of the acetylamino group suggests potential for hydrogen bonding and reactivity in various chemical environments. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic ethoxy and aromatic components, while the polar acetylamino group may enhance solubility in polar solvents to some extent. Its molecular structure indicates potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of bioactive compounds. Additionally, the compound may exhibit specific biological activities, which would be of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity.
Formula:C12H15NO4
InChI:InChI=1S/C12H15NO4/c1-4-17-11-6-5-9(12(15)16-3)7-10(11)13-8(2)14/h5-7H,4H2,1-3H3,(H,13,14)
InChI key:InChIKey=SUDAUWMVRKOWIM-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(OCC)C=CC(C(OC)=O)=C1
Synonyms:
  • Methyl 3-(acetylamino)-4-ethoxybenzoate
  • Benzoic acid, 3-(acetylamino)-4-ethoxy-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.