CymitQuimica logo

CAS 1201148-87-9

:

6-Fluoro-3-formyl-1H-indole-7-carbonitrile

Description:
6-Fluoro-3-formyl-1H-indole-7-carbonitrile is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a formyl group (-CHO) at the 3-position and a cyano group (-CN) at the 7-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The fluorine atom at the 6-position can influence the compound's electronic properties and lipophilicity, potentially enhancing its biological activity. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its unique functional groups allow for various chemical transformations, which can be exploited in synthetic pathways. Additionally, the compound's stability and solubility characteristics are important for its application in biological systems. Overall, 6-Fluoro-3-formyl-1H-indole-7-carbonitrile represents a versatile scaffold in the field of organic chemistry and medicinal research.
Formula:C10H5FN2O
InChI:InChI=1S/C10H5FN2O/c11-9-2-1-7-6(5-14)4-13-10(7)8(9)3-12/h1-2,4-5,13H
InChI key:InChIKey=KCJLLPIWSLBIHF-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(C(C=O)=CN2)=CC=C1F
Synonyms:
  • 1H-Indole-7-carbonitrile, 6-fluoro-3-formyl-
  • 6-Fluoro-3-formyl-1H-indole-7-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.