CAS 120121-01-9
:(R)-1-(2-chlorophenyl)ethanol
Description:
(R)-1-(2-chlorophenyl)ethanol, with the CAS number 120121-01-9, is an organic compound characterized by its chiral structure, which includes a hydroxyl group (-OH) attached to a carbon atom that is also bonded to a 2-chlorophenyl group. This compound typically exhibits properties associated with alcohols, such as being a polar molecule due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The presence of the chlorophenyl group introduces additional characteristics, including potential reactivity and influence on the compound's solubility in various solvents. The chirality of the molecule means it can exist in two enantiomeric forms, with the (R)-configuration being one of them, which can affect its biological activity and interactions in chemical reactions. This compound may be of interest in pharmaceutical applications or as an intermediate in organic synthesis, where the specific stereochemistry can play a crucial role in the efficacy and behavior of the resulting products.
Formula:C8H9ClO
InChI:InChI=1S/C8H9ClO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3/t6-/m1/s1
InChI key:QYUQVBHGBPRDKN-ZCFIWIBFSA-N
SMILES:C[C@H](C1=CC(=CC=C1)Cl)O
Synonyms:- (R)-1-(2-chlorophenylethanol
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(R)-1-(3-Chlorophenyl)ethan-1-ol
CAS:(R)-1-(3-Chlorophenyl)ethan-1-olFormula:C8H9ClOPurity:98%Molecular weight:156.612(R)-1-(3-Chlorophenyl)ethanol
CAS:Formula:C8H9ClOPurity:95%Color and Shape:LiquidMolecular weight:156.6095(R)-1-(3-Chlorophenyl)ethanol
CAS:(R)-1-(3-Chlorophenyl)ethanolFormula:C8H9ClOPurity:95%Molecular weight:156.61(R)-1-(3-Chlorophenyl)ethanol
CAS:(R)-1-(3-Chlorophenyl)ethanol is a molecule that is expressed in Rhodobacter capsulatus. It has been shown to integrate advances in molecular modeling with advances in enzymology, which has allowed for the design and synthesis of enantiopure compounds. This molecule has also been shown to be homochiral and heterologous, which makes it an ideal candidate for the development of stereoselective catalytic processes. (R)-1-(3-Chlorophenyl)ethanol is able to act as a dehydrogenase and can be used for cloning nature's enzymes.
Formula:C8H9ClOPurity:Min. 95%Molecular weight:156.61 g/mol
