
CAS 1201221-84-2
:1,1-Dimethylethyl 2-isoxazolidinecarboxylate
Description:
1,1-Dimethylethyl 2-isoxazolidinecarboxylate, identified by its CAS number 1201221-84-2, is a chemical compound characterized by its unique structural features, including a 2-isoxazolidine ring and a tert-butyl group. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid with a pleasant odor. It is soluble in organic solvents and may have limited solubility in water. The presence of the isoxazolidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to participate in various chemical reactions. Additionally, the tert-butyl group can influence the compound's steric properties, potentially affecting its reactivity and interaction with biological targets. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 1,1-Dimethylethyl 2-isoxazolidinecarboxylate represents a compound of interest in both synthetic and applied chemistry contexts.
Formula:C8H15NO3
InChI:InChI=1S/C8H15NO3/c1-8(2,3)12-7(10)9-5-4-6-11-9/h4-6H2,1-3H3
InChI key:InChIKey=HDULXEDSECOGMJ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCCO1
Synonyms:- 2-Isoxazolidinecarboxylic acid, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 2-isoxazolidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.