
CAS 120124-51-8
:N2-(2,3-Dihydroxybenzoyl)-D-lysyl-L-serine
Description:
N2-(2,3-Dihydroxybenzoyl)-D-lysyl-L-serine, with the CAS number 120124-51-8, is a synthetic compound that features a combination of amino acids and a dihydroxybenzoyl moiety. This compound is characterized by its structural complexity, which includes a lysine residue linked to a serine residue, both of which are amino acids that play crucial roles in protein synthesis and function. The presence of the 2,3-dihydroxybenzoyl group suggests potential applications in biochemical research, particularly in studies involving enzyme interactions or as a ligand in various biochemical assays. The compound may exhibit specific solubility properties, depending on the pH and solvent conditions, and could participate in hydrogen bonding due to the hydroxyl groups present in the dihydroxybenzoyl moiety. Additionally, its unique structure may confer biological activity, making it of interest in pharmacological studies. Overall, N2-(2,3-Dihydroxybenzoyl)-D-lysyl-L-serine represents a fascinating intersection of organic chemistry and biochemistry, with potential implications in drug design and molecular biology.
Formula:C16H23N3O7
InChI:InChI=1S/C16H23N3O7/c17-7-2-1-5-10(15(24)19-11(8-20)16(25)26)18-14(23)9-4-3-6-12(21)13(9)22/h3-4,6,10-11,20-22H,1-2,5,7-8,17H2,(H,18,23)(H,19,24)(H,25,26)/t10-,11+/m1/s1
InChI key:InChIKey=NNTXFOAPABMVEG-MNOVXSKESA-N
SMILES:C(N[C@@H](C(N[C@H](C(O)=O)CO)=O)CCCCN)(=O)C1=C(O)C(O)=CC=C1
Synonyms:- L-Serine, N2-(2,3-dihydroxybenzoyl)-D-lysyl-
- Chrysobactin
- N2-(2,3-Dihydroxybenzoyl)-D-lysyl-L-serine
- L-Serine, N-[N2-(2,3-dihydroxybenzoyl)-D-lysyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Chrysobactin
CAS:<p>Chrysobactin has siderophore activity that is isolated from Erwinia chrysanthemi.</p>Formula:C16H23N3O7Color and Shape:SolidMolecular weight:369.37
