
CAS 1201363-85-0
:(αS)-3-Fluoro-α-methyl-2-pyridinemethanamine
Description:
(αS)-3-Fluoro-α-methyl-2-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a fluorine atom at the 3-position of the pyridine ring and a methyl group at the α-position contributes to its unique properties. This compound is classified as an amine due to the presence of an amino group (-NH2) attached to the pyridine structure. Its stereochemistry is indicated by the (αS) designation, suggesting a specific spatial arrangement of its atoms, which can influence its biological activity and interactions. The compound may exhibit potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Additionally, the fluorine substitution can enhance lipophilicity and metabolic stability, making it a subject of interest in drug design. As with many amines, it may also participate in various chemical reactions, including alkylation and acylation, further expanding its utility in synthetic chemistry.
Formula:C7H9FN2
InChI:InChI=1S/C7H9FN2/c1-5(9)7-6(8)3-2-4-10-7/h2-5H,9H2,1H3/t5-/m0/s1
InChI key:InChIKey=OQOGUSGSVBLLPD-YFKPBYRVSA-N
SMILES:[C@@H](C)(N)C1=C(F)C=CC=N1
Synonyms:- (1S)-1-(3-Fluoropyridin-2-yl)ethan-1-amine
- (αS)-3-Fluoro-α-methyl-2-pyridinemethanamine
- 2-Pyridinemethanamine, 3-fluoro-α-methyl-, (αS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.