CAS 120138-50-3
:Quinupristin
Description:
Quinupristin is a semi-synthetic antibiotic that belongs to the streptogramin class of antibiotics, primarily used in combination with dalfopristin to treat serious infections caused by Gram-positive bacteria, including vancomycin-resistant Enterococcus faecium. It functions by inhibiting bacterial protein synthesis, specifically targeting the 50S ribosomal subunit. Quinupristin exhibits a broad spectrum of activity against various pathogens, making it effective in treating conditions such as skin and soft tissue infections, as well as complicated intra-abdominal infections. The compound is known for its unique mechanism of action, which involves binding to distinct sites on the ribosome, leading to synergistic effects when used in combination with dalfopristin. Quinupristin is typically administered intravenously and may cause side effects such as gastrointestinal disturbances and potential hepatotoxicity. Its use is often reserved for cases where other antibiotics are ineffective due to resistance, highlighting its importance in the fight against antibiotic-resistant bacteria.
Formula:C53H67N9O10S
InChI:InChI=1/C53H67N9O10S/c1-6-37-50(68)61-23-11-14-38(61)51(69)59(5)40(26-32-16-18-36(19-17-32)58(3)4)52(70)62-28-35(30-73-43-29-60-24-20-33(43)21-25-60)42(64)27-39(62)47(65)57-45(34-12-8-7-9-13-34)53(71)72-31(2)44(48(66)55-37)56-49(67)46-41(63)15-10-22-54-46/h7-10,12-13,15-19,22,31,33,35,37-40,43-45,63H,6,11,14,20-21,23-30H2,1-5H3,(H,55,66)(H,56,67)(H,57,65)/t31-,35+,37?,38+,39?,40+,43-,44+,45+/m1/s1
Synonyms:- Quinupristin [USAN:INN]
- N-((6R,9S,10R,13S,15aS,18R,22S,24aS)-22-(p-(Dimethylamino)benzyl)-6-ethyldocosahydro-10,23-dimethyl-5,8,12,15,17,21,24-heptaoxo-13-phenyl-18-(((3S)-3-quinuclidinylthio)methyl)-12H-pyrido(2,1-f)pyrrolo(2,1-l)(1,4,7,10,13,16)oxapentaazacyclononadecin-9-yl)-3-hydroxypicolinamide
- Quinupristina
- Quinupristina [INN-Spanish]
- Quinupristine
- Quinupristine [INN-French]
- Quinupristinum
- Quinupristinum [INN-Latin]
- Unii-23Ow28Rs7P
- Virginiamycin S1, 4-(4-(dimethylamino)-N-methyl-L-phenylalanine)-5-(5-((1-azabicyclo(2.2.2)oct-3-ylthio)methyl)-4-oxo-L-2-piperidinecarboxylic acid)-, (S)-
- N-{18-[(1-azabicyclo[2.2.2]oct-3-ylsulfanyl)methyl]-22-[4-(dimethylamino)benzyl]-6-ethyl-10,23-dimethyl-5,8,12,15,17,21,24-heptaoxo-13-phenyldocosahydro-12H-pyrido[2,1-f]pyrrolo[2,1-l][1,4,7,10,13,16]oxapentaazacyclononadecin-9-yl}-3-hydroxypyridine-2-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Quinupristin
CAS:<p>Quinupristin, a macrolide-lincosamide-streptogramin antibiotic, inhibits protein synthesis in bacteria.</p>Formula:C53H67N9O10SPurity:98.05% - 98.16%Color and Shape:SolidMolecular weight:1022.22Quinupristin
CAS:<p>Quinupristin is a semi-synthetic antibiotic, which is derived from the natural compound pristinamycin IIA produced by the bacterium Streptomyces pristinaespiralis. It operates by binding to the 50S ribosomal subunit in bacterial cells, inhibiting protein synthesis and thus exerting a bacteriostatic effect. This mechanism effectively disrupts the growth and proliferation of susceptible bacteria.</p>Formula:C53H67N9O10SPurity:Min. 95%Molecular weight:1,022.22 g/mol




