CAS 120139-91-5

8-Methyl-5-quinolinemethanol

Description:

8-Methyl-5-quinolinemethanol, identified by its CAS number 120139-91-5, is an organic compound that features a quinoline structure, which is a bicyclic aromatic compound consisting of a benzene ring fused to a pyridine ring. This compound is characterized by the presence of a hydroxymethyl group (-CH2OH) attached to the quinoline ring, specifically at the 5-position, and a methyl group (-CH3) at the 8-position. The presence of these functional groups contributes to its potential reactivity and solubility properties. 8-Methyl-5-quinolinemethanol may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest that it could participate in hydrogen bonding due to the hydroxymethyl group, influencing its interactions with other molecules. Additionally, the aromatic nature of the quinoline moiety may contribute to its stability and electronic properties. Overall, this compound's unique structure positions it as a candidate for further research in various chemical and biological applications.

Formula: C₁₁H₁₁NO

InChI: InChI=1S/C11H11NO/c1-8-4-5-9(7-13)10-3-2-6-12-11(8)10/h2-6,13H,7H2,1H3

InChI key: InChIKey=ZDZBCAXDZRABLB-UHFFFAOYSA-N

SMILES: C(O)C=1C2=C(C(C)=CC1)N=CC=C2

Synonyms:

• 8-Methyl-5-quinolinemethanol
• (8-Methylquinolin-5-yl)methanol
• 5-Quinolinemethanol, 8-methyl-
• 8-Methyl-5-hydroxymethylquinoline