CymitQuimica logo

CAS 120143-20-6

:

2-AMINO-4-AZIDOBUTANOICACID

Description:
2-Amino-4-azidobutanoic acid, with the CAS number 120143-20-6, is an amino acid derivative characterized by the presence of an azido group (-N3) at the 4-position of the butanoic acid chain. This compound features a basic amino group (-NH2) at one end, which contributes to its classification as an amino acid. The azido group is notable for its reactivity, particularly in click chemistry applications, making this compound of interest in various synthetic and medicinal chemistry contexts. The presence of both the amino and azido functionalities allows for potential modifications and conjugations, enhancing its utility in bioconjugation and drug development. Typically, such compounds are soluble in polar solvents, and their stability can be influenced by environmental factors such as pH and temperature. As with many azido compounds, caution is advised due to the potential for explosive decomposition under certain conditions. Overall, 2-amino-4-azidobutanoic acid serves as a versatile building block in chemical synthesis and research.
Formula:C4H8N4O2
InChI:InChI=1/C4H8N4O2/c5-3(4(9)10)1-2-7-8-6/h3H,1-2,5H2,(H,9,10)
Synonyms:
  • Butanoic acid, 2-amino-4-azido-, (+-)-
  • CCRIS 3365
  • (+-)-2-Amino-4-azidobutanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.