CAS 1201438-56-3: IPI 145
Description:IPI-145, also known as duvelisib, is a small molecule inhibitor that targets phosphoinositide 3-kinase (PI3K) pathways, specifically the delta and gamma isoforms. It is primarily investigated for its potential therapeutic applications in hematological malignancies, including certain types of lymphoma and leukemia. IPI-145 exhibits anti-tumor activity by disrupting the signaling pathways that promote cell proliferation and survival in cancer cells. The compound is typically administered orally and has been evaluated in clinical trials for its efficacy and safety profile. Its mechanism of action involves the inhibition of PI3K, which plays a crucial role in various cellular processes, including metabolism, growth, and survival. As with many targeted therapies, the side effects may include immune-related reactions, gastrointestinal disturbances, and hematological changes. Ongoing research continues to explore its full potential and optimize its use in combination with other therapies for enhanced treatment outcomes in oncology.
Formula:C22H17ClN6O
InChI:InChI=1S/C22H17ClN6O/c1-13(28-21-19-20(25-11-24-19)26-12-27-21)17-10-14-6-5-9-16(23)18(14)22(30)29(17)15-7-3-2-4-8-15/h2-13H,1H3,(H2,24,25,26,27,28)/t13-/m0/s1
InChI key:InChIKey=SJVQHLPISAIATJ-ZDUSSCGKSA-N
SMILES:O=C1C=2C(Cl)=CC=CC2C=C(N1C=3C=CC=CC3)C(NC4=NC=NC=5N=CNC54)C
- Synonyms:
- 1(2H)-Isoquinolinone, 8-chloro-2-phenyl-3-[(1S)-1-(9H-purin-6-ylamino)ethyl]-
- 8-Chloro-2-phenyl-3-[(1S)-1-(9H-purin-6-ylamino)ethyl]-1(2H)-isoquinolinone
- Copiktra
- Ink 1197
- Ink1197
- Ipi 145
- Duvelisib