CAS 120153-08-4

5-(dihydroxyboranyl)-2-fluorobenzoic acid

Description:

5-(Dihydroxyboranyl)-2-fluorobenzoic acid is an organoboron compound characterized by the presence of a boron atom bonded to two hydroxyl groups and a fluorinated aromatic ring. The compound features a benzoic acid moiety, which contributes to its acidic properties due to the carboxylic acid functional group. The presence of the fluorine atom on the aromatic ring can influence the compound's reactivity and polarity, potentially enhancing its biological activity or solubility in certain solvents. The dihydroxyboranyl group may serve as a versatile functional handle for further chemical modifications, making it valuable in synthetic organic chemistry and materials science. Additionally, compounds containing boron are often studied for their applications in pharmaceuticals, agrochemicals, and as catalysts in various chemical reactions. The specific interactions and stability of this compound can be influenced by factors such as pH, temperature, and the presence of other functional groups in a reaction environment.

Formula: C₇H₆BFO₄

InChI: InChI=1/C7H6BFO4/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,12-13H,(H,10,11)

SMILES: c1cc(c(cc1B(O)O)F)C(=O)O

Synonyms:

• 4-Carboxy-3-fluorobenzeneboronic acid
• 4-Carboxy-3-fluorophenylboronic acid

4-Carboxy-3-fluorobenzeneboronic acid, 98%

CAS: 120153-08-4

4-Carboxy-3-fluorobenzeneboronic acid is used as intermediates. Also used in the coupling reaction. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar

Formula: C₇H₆BFO₄

Purity: 98%

Molecular weight: 183.93

Ref: 02-H53285

Benzoic acid, 4-borono-2-fluoro-

CAS: 120153-08-4

Formula: C₇H₆BFO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 183.9295

Ref: IN-DA000QE8

4-Carboxy-3-fluorophenylboronic acid

CAS: 120153-08-4

Formula: C₇H₆BFO₄

Purity: ≥ 98.0%

Color and Shape: White to off-white powder

Molecular weight: 183.93

Ref: 7W-GK5882

4-Carboxy-3-fluorobenzeneboronic acid

CAS: 120153-08-4

4-Carboxy-3-fluorobenzeneboronic acid

Formula: C₇H₆BFO₄

Purity: 97%

Color and Shape: white solid

Molecular weight: 183.93g/mol

Ref: 54-PC1644

4-Carboxy-3-fluorophenylboronic acid

CAS: 120153-08-4

Formula: C₇H₆BFO₄

Purity: 97%

Color and Shape: Solid, Powder or Solid

Molecular weight: 183.93

Ref: 10-F033088