CAS 120153-08-4
:5-(dihydroxyboranyl)-2-fluorobenzoic acid
Description:
5-(Dihydroxyboranyl)-2-fluorobenzoic acid is an organoboron compound characterized by the presence of a boron atom bonded to two hydroxyl groups and a fluorinated aromatic ring. The compound features a benzoic acid moiety, which contributes to its acidic properties due to the carboxylic acid functional group. The presence of the fluorine atom on the aromatic ring can influence the compound's reactivity and polarity, potentially enhancing its biological activity or solubility in certain solvents. The dihydroxyboranyl group may serve as a versatile functional handle for further chemical modifications, making it valuable in synthetic organic chemistry and materials science. Additionally, compounds containing boron are often studied for their applications in pharmaceuticals, agrochemicals, and as catalysts in various chemical reactions. The specific interactions and stability of this compound can be influenced by factors such as pH, temperature, and the presence of other functional groups in a reaction environment.
Formula:C7H6BFO4
InChI:InChI=1/C7H6BFO4/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,12-13H,(H,10,11)
SMILES:c1cc(c(cc1B(O)O)F)C(=O)O
Synonyms:- 4-Carboxy-3-fluorobenzeneboronic acid
- 4-Carboxy-3-fluorophenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Carboxy-3-fluorobenzeneboronic acid, 98%
CAS:<p>4-Carboxy-3-fluorobenzeneboronic acid is used as intermediates. Also used in the coupling reaction. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar </p>Formula:C7H6BFO4Purity:98%Molecular weight:183.93Benzoic acid, 4-borono-2-fluoro-
CAS:Formula:C7H6BFO4Purity:98%Color and Shape:SolidMolecular weight:183.92954-Carboxy-3-fluorophenylboronic acid
CAS:Formula:C7H6BFO4Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:183.934-Carboxy-3-fluorobenzeneboronic acid
CAS:<p>4-Carboxy-3-fluorobenzeneboronic acid</p>Formula:C7H6BFO4Purity:97%Color and Shape: white solidMolecular weight:183.93g/mol4-Carboxy-3-fluorophenylboronic acid
CAS:Formula:C7H6BFO4Purity:97%Color and Shape:Solid, Powder or SolidMolecular weight:183.93




