CymitQuimica logo

CAS 120153-09-5

:

Boronic acid, (4′-ethyl-3′-fluoro[1,1′-biphenyl]-4-yl)-

Description:
Boronic acids are a class of organic compounds characterized by the presence of a boron atom bonded to a hydroxyl group and an organic substituent. The compound "Boronic acid, (4′-ethyl-3′-fluoro[1,1′-biphenyl]-4-yl)-" features a biphenyl structure with an ethyl group and a fluorine atom at specific positions, which influences its chemical reactivity and physical properties. Typically, boronic acids are known for their ability to form reversible complexes with diols, making them valuable in organic synthesis and medicinal chemistry. They can participate in various reactions, including Suzuki coupling, which is crucial for forming carbon-carbon bonds. The presence of the ethyl and fluoro substituents can enhance the compound's solubility and reactivity, potentially affecting its application in drug development or material science. Additionally, boronic acids often exhibit moderate acidity, allowing them to act as Lewis acids in coordination chemistry. Overall, this compound's unique structure and functional groups contribute to its utility in various chemical applications.
Formula:C14H14BFO2
InChI:InChI=1S/C14H14BFO2/c1-2-10-3-4-12(9-14(10)16)11-5-7-13(8-6-11)15(17)18/h3-9,17-18H,2H2,1H3
InChI key:InChIKey=GDRWUWXCJJOEIW-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1CC)C2=CC=C(B(O)O)C=C2
Synonyms:
  • Boronic acid, (4′-ethyl-3′-fluoro[1,1′-biphenyl]-4-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.