
CAS 120157-99-5
:1,1-Dimethylethyl N-(1-oxopropyl)carbamate
Description:
1,1-Dimethylethyl N-(1-oxopropyl)carbamate, with the CAS number 120157-99-5, is an organic compound that belongs to the class of carbamates. This substance features a carbamate functional group, which is characterized by the presence of a carbonyl (C=O) linked to a nitrogen atom (N) that is also connected to an alkyl or aryl group. The presence of the 1,1-dimethylethyl group indicates that it has bulky substituents, which can influence its reactivity and steric properties. The N-(1-oxopropyl) moiety suggests that it contains a propanoyl group, contributing to its potential applications in various chemical reactions or as an intermediate in organic synthesis. Generally, carbamates can exhibit a range of biological activities, including potential use as pesticides or pharmaceuticals. The specific characteristics, such as solubility, melting point, and stability, would depend on the molecular structure and the environment in which the compound is used. Safety data and handling precautions should be consulted for practical applications.
Formula:C8H15NO3
InChI:InChI=1S/C8H15NO3/c1-5-6(10)9-7(11)12-8(2,3)4/h5H2,1-4H3,(H,9,10,11)
InChI key:InChIKey=RXGHOITZVRRVCE-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C(NC(CC)=O)=O
Synonyms:- Carbamic acid, (1-oxopropyl)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-(1-oxopropyl)carbamate
- Carbamic acid, N-(1-oxopropyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
