CymitQuimica logo

CAS 1201597-39-8

:

2-(Chloromethyl)-7-(trifluoromethyl)imidazo[1,2-a]pyridine

Description:
2-(Chloromethyl)-7-(trifluoromethyl)imidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a chloromethyl group enhances its reactivity, making it a potential intermediate in various synthetic applications. The trifluoromethyl group is notable for imparting significant lipophilicity and influencing the compound's electronic properties, often enhancing biological activity. This compound typically exhibits a solid-state at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the trifluoromethyl group. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the imidazo[1,2-a]pyridine framework is known for its biological activity. Additionally, the compound's stability and reactivity can be influenced by the presence of the halogen and trifluoromethyl substituents, making it a subject of interest in both synthetic and medicinal chemistry research. Safety and handling precautions should be observed due to the presence of chlorine and fluorine, which can pose health and environmental risks.
Formula:C9H6ClF3N2
InChI:InChI=1S/C9H6ClF3N2/c10-4-7-5-15-2-1-6(9(11,12)13)3-8(15)14-7/h1-3,5H,4H2
InChI key:InChIKey=XLQLGNBGVKYTLV-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC=2N(C=C(CCl)N2)C=C1
Synonyms:
  • Imidazo[1,2-a]pyridine, 2-(chloromethyl)-7-(trifluoromethyl)-
  • 2-(Chloromethyl)-7-(trifluoromethyl)imidazo[1,2-a]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.