CAS 120161-06-0

1H-Benzimidazole,2-(1-pyrrolidinyl)-(9CI)

Description:

1H-Benzimidazole, 2-(1-pyrrolidinyl)-(9CI), with the CAS number 120161-06-0, is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure consisting of a fused benzene and imidazole ring. The presence of a pyrrolidine group at the 2-position of the benzimidazole enhances its potential for various biological activities. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the benzimidazole and pyrrolidine moieties, which are known to interact with biological targets. Additionally, the compound may exhibit properties such as fluorescence or specific reactivity due to the functional groups present. As with many organic compounds, safety and handling precautions should be observed, as its biological effects and toxicity profiles would need to be evaluated in a laboratory setting.

Formula: C₁₁H₁₃N₃

InChI: InChI=1/C11H13N3/c1-2-6-10-9(5-1)12-11(13-10)14-7-3-4-8-14/h1-2,5-6H,3-4,7-8H2,(H,12,13)

SMILES: c1ccc2c(c1)nc([nH]2)N1CCCC1

Synonyms:

• 1H-benzimidazole, 2-(1-pyrrolidinyl)-
• 2-pyrrolidin-1-yl-1H-benzimidazole