CymitQuimica logo

CAS 120161-08-2

:

3-(1H-Benzimidazol-2-ylamino)-1-propanol

Description:
3-(1H-Benzimidazol-2-ylamino)-1-propanol, with the CAS number 120161-08-2, is a chemical compound characterized by its unique structural features, which include a benzimidazole moiety and a propanol group. This compound typically exhibits properties such as solubility in polar solvents due to the presence of hydroxyl and amino functional groups, which can engage in hydrogen bonding. The benzimidazole ring contributes to its potential biological activity, as compounds containing this structure are often associated with various pharmacological effects. The presence of the amino group may enhance its reactivity and ability to form complexes with metal ions or other biological molecules. Additionally, the compound may exhibit moderate to high stability under standard laboratory conditions, although specific stability can depend on environmental factors such as pH and temperature. Overall, 3-(1H-Benzimidazol-2-ylamino)-1-propanol is of interest in medicinal chemistry and may serve as a lead compound for further development in therapeutic applications.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c14-7-3-6-11-10-12-8-4-1-2-5-9(8)13-10/h1-2,4-5,14H,3,6-7H2,(H2,11,12,13)
InChI key:InChIKey=CVFJELUAPZTLRC-UHFFFAOYSA-N
SMILES:N(CCCO)C=1NC=2C(N1)=CC=CC2
Synonyms:
  • 3-((1H-Benzo[d]imidazol-2-yl)amino)propan-1-ol
  • 2-(3-Hydroxypropylamino)benzimidazole
  • 3-(1H-Benzimidazol-2-ylamino)-1-propanol
  • 3-[(1H-1,3-Benzodiazol-2-yl)amino]propan-1-ol
  • 1-Propanol, 3-(1H-benzimidazol-2-ylamino)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.