CAS 120162-55-2: Azimsulfuron
Description:Azimsulfuron is a selective herbicide primarily used for controlling broadleaf weeds and certain grasses in various crops, particularly in rice and other cereal crops. It belongs to the sulfonylurea class of herbicides, which function by inhibiting the enzyme acetolactate synthase (ALS), crucial for the synthesis of essential amino acids in plants. This inhibition leads to the cessation of growth and eventual death of the targeted weeds. Azimsulfuron is characterized by its high efficacy at low application rates, making it an environmentally favorable option compared to some traditional herbicides. It is typically applied pre-emergence or post-emergence, depending on the specific weed species and crop type. The compound is generally stable under normal environmental conditions but can degrade in the presence of strong acids or bases. Its solubility in water and organic solvents allows for various formulation types, including granules and liquid concentrates. As with many herbicides, proper handling and application are essential to minimize potential environmental impact and ensure safety.
Formula:C13H16N10O5S
InChI:InChI=1S/C13H16N10O5S/c1-22-11(7(6-14-22)10-18-21-23(2)19-10)29(25,26)20-13(24)17-12-15-8(27-3)5-9(16-12)28-4/h5-6H,1-4H3,(H2,15,16,17,20,24)
InChI key:InChIKey=MAHPNPYYQAIOJN-UHFFFAOYSA-N
SMILES:O=C(NC=1N=C(OC)C=C(N1)OC)NS(=O)(=O)C2=C(C=NN2C)C=3N=NN(N3)C
- Synonyms:
- 1H-Pyrazole-5-Sulfonamide,N-(((4,6-Dimethoxy-2-Pyrimidinyl)Amino)Carbonyl)-1-M
- 1H-Pyrazole-5-sulfonamide, N-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-1-methyl-4-(2-methyl-2H-tetrazol-5-yl)-
- 3-(4,6-Dimethoxypyrimidin-2-yl)-1-[2-methyl-4-(2-methyltetrazol-5-yl)pyrazol-3-yl]sulfonyl-urea
- A8947
- Dpx 47
- Dpx-A 8947
- Dpx-A8947
- Dpx47
- Ethyl-4-(2-Methyl-2H-Tetrazol-5-Yl)-
- Gulliver
- See more synonyms
- In-A 8947
- In-A8947
- N-[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]-1-methyl-4-(2-methyl-2H-tetrazol-5-yl)-1H-pyrazole-5-sulfonamide
- N-[[(4,6-Dimethoxy-2-pyrimidinyl)amino]carbonyl]-1-methyl-4-(2-methyl-2H-tetrazol-5-yl)-1H-pyrazole-5-sulfonamide
- Azimsulfuron