
CAS 120162-82-5
:1-Methyl-1,3-diazaspiro[4.4]nonan-2-one
Description:
1-Methyl-1,3-diazaspiro[4.4]nonan-2-one is a bicyclic organic compound characterized by its unique spiro structure, which consists of two interconnected rings sharing a single atom. The presence of two nitrogen atoms in the diaza configuration contributes to its basicity and potential reactivity, making it of interest in various chemical applications. The compound features a carbonyl group (ketone) at the 2-position, which can participate in nucleophilic addition reactions. Its molecular structure suggests potential for interactions with biological systems, possibly influencing pharmacological properties. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Additionally, the presence of the methyl group enhances its steric properties and may influence its conformational dynamics. Overall, 1-Methyl-1,3-diazaspiro[4.4]nonan-2-one is a compound of interest in synthetic chemistry and medicinal chemistry, with potential applications in drug development and materials science.
Formula:C8H14N2O
InChI:InChI=1S/C8H14N2O/c1-10-7(11)9-6-8(10)4-2-3-5-8/h2-6H2,1H3,(H,9,11)
InChI key:InChIKey=AJDADPIPXMWKNL-UHFFFAOYSA-N
SMILES:CN1C2(CNC1=O)CCCC2
Synonyms:- 1-Methyl-1,3-diazaspiro[4.4]nonan-2-one
- 1,3-Diazaspiro[4.4]nonan-2-one, 1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.