CAS 1201633-50-2
:1-(2-Thienylmethyl)-2-piperazineethanol
Description:
1-(2-Thienylmethyl)-2-piperazineethanol is a chemical compound characterized by its unique structure, which includes a piperazine ring and a thienylmethyl group. This compound typically exhibits properties associated with both piperazine derivatives and thienyl compounds, such as potential psychoactive effects and interactions with various neurotransmitter systems. It is likely to be a polar molecule due to the presence of the hydroxyl (-OH) group, which can influence its solubility in water and organic solvents. The thienyl group may contribute to its aromatic characteristics, potentially affecting its reactivity and biological activity. As with many piperazine derivatives, this compound may be investigated for its pharmacological properties, including anxiolytic or antidepressant effects. However, specific data regarding its toxicity, stability, and detailed reactivity would require further empirical studies. Overall, 1-(2-Thienylmethyl)-2-piperazineethanol represents a compound of interest in medicinal chemistry and pharmacology, warranting further exploration for its potential applications.
Formula:C11H18N2OS
InChI:InChI=1S/C11H18N2OS/c14-6-3-10-8-12-4-5-13(10)9-11-2-1-7-15-11/h1-2,7,10,12,14H,3-6,8-9H2
InChI key:InChIKey=WQVGIZGOKJMFRN-UHFFFAOYSA-N
SMILES:C(N1C(CCO)CNCC1)C2=CC=CS2
Synonyms:- 2-Piperazineethanol, 1-(2-thienylmethyl)-
- 1-(2-Thienylmethyl)-2-piperazineethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.