
CAS 1201633-51-3
:Benzenamine, 3-nitro-N-propyl-, hydrochloride (1:1)
Description:
Benzenamine, 3-nitro-N-propyl-, hydrochloride (1:1) is an organic compound characterized by its amine functional group and a nitro substituent on the benzene ring. The presence of the propyl group contributes to its hydrophobic characteristics, while the hydrochloride form indicates that it is a salt, enhancing its solubility in water. This compound typically exhibits properties associated with aromatic amines, such as potential reactivity in electrophilic substitution reactions due to the electron-withdrawing nitro group. The hydrochloride form often stabilizes the amine, making it less basic compared to its free base counterpart. In terms of safety, compounds containing nitro groups can be hazardous, as they may be toxic or carcinogenic, necessitating careful handling and appropriate safety measures. Additionally, the compound may have applications in organic synthesis or as an intermediate in the production of dyes, pharmaceuticals, or agrochemicals. As with any chemical substance, understanding its properties, reactivity, and safety profile is crucial for its effective and safe use in various applications.
Formula:C9H12N2O2·ClH
InChI:InChI=1S/C9H12N2O2.ClH/c1-2-6-10-8-4-3-5-9(7-8)11(12)13;/h3-5,7,10H,2,6H2,1H3;1H
InChI key:InChIKey=KLVIOEPFHWKBBQ-UHFFFAOYSA-N
SMILES:N(CCC)C1=CC(N(=O)=O)=CC=C1.Cl
Synonyms:- Benzenamine, 3-nitro-N-propyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.