CAS 1201633-52-4

Benzenemethanamine, 4-ethoxy-α-ethyl-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-ethoxy-α-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and aromatic structure. It features a benzene ring substituted with an ethoxy group and an ethyl group, which contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amine group suggests potential basicity and reactivity, making it suitable for interactions with acids and other electrophiles. This compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its molecular structure allows for potential applications in drug development, particularly in the synthesis of compounds targeting specific biological pathways. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, the characteristics of this compound make it a subject of interest in both research and industrial contexts.

Formula: C₁₁H₁₇NO·ClH

InChI: InChI=1S/C11H17NO.ClH/c1-3-11(12)9-5-7-10(8-6-9)13-4-2;/h5-8,11H,3-4,12H2,1-2H3;1H

InChI key: InChIKey=MZAWIUQNMJTCHM-UHFFFAOYSA-N

SMILES: C(CC)(N)C1=CC=C(OCC)C=C1.Cl

Synonyms:

• Benzenemethanamine, 4-ethoxy-α-ethyl-, hydrochloride (1:1)
• [1-(4-Ethoxyphenyl)propyl]amine hydrochloride

[1-(4-ethoxyphenyl)propyl]amine hydrochloride

CAS: 1201633-52-4

Formula: C₁₁H₁₈ClNO

Purity: 95.0%

Molecular weight: 215.72

Ref: 10-F359779