CAS 1201633-60-4

Benzeneethanamine, 3-(3-methylbutoxy)-, hydrochloride (1:1)

Description:

Benzeneethanamine, 3-(3-methylbutoxy)-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and aromatic structure. It features a benzene ring attached to an ethylamine chain, with a 3-(3-methylbutoxy) substituent that enhances its hydrophobic properties. The hydrochloride form indicates that the compound is a salt, which typically improves its solubility in water and stability. This compound may exhibit biological activity due to its amine structure, potentially interacting with various biological targets. Its molecular structure suggests it could be used in pharmaceutical applications or as a building block in organic synthesis. Safety data and handling precautions should be considered, as amines can be irritants and may pose health risks. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be essential for practical applications and should be referenced from reliable chemical databases or literature for specific values.

Formula: C₁₃H₂₁NO·ClH

InChI: InChI=1S/C13H21NO.ClH/c1-11(2)7-9-15-13-5-3-4-12(10-13)6-8-14;/h3-5,10-11H,6-9,14H2,1-2H3;1H

InChI key: InChIKey=GMGBGQDZCWNLLX-UHFFFAOYSA-N

SMILES: O(CCC(C)C)C1=CC(CCN)=CC=C1.Cl

Synonyms:

• Benzeneethanamine, 3-(3-methylbutoxy)-, hydrochloride (1:1)