CAS 1201633-62-6

1-Naphthalenemethanamine, 2-butoxy-, hydrochloride (1:1)

Description:

1-Naphthalenemethanamine, 2-butoxy-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and naphthalene structure, which contributes to its aromatic properties. The presence of the butoxy group enhances its solubility in organic solvents and may influence its biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in laboratory settings. This compound may exhibit various pharmacological properties, potentially acting as a neurotransmitter or modulator due to its amine structure. Its molecular interactions can be influenced by the naphthalene ring, which can participate in π-π stacking and hydrophobic interactions. Safety data sheets should be consulted for handling precautions, as amines can be irritants and may pose health risks. Overall, this compound's unique structure and properties make it of interest in both synthetic chemistry and potential therapeutic applications.

Formula: C₁₅H₁₉NO·ClH

InChI: InChI=1S/C15H19NO.ClH/c1-2-3-10-17-15-9-8-12-6-4-5-7-13(12)14(15)11-16;/h4-9H,2-3,10-11,16H2,1H3;1H

InChI key: InChIKey=NAZNILQODRXFAJ-UHFFFAOYSA-N

SMILES: C(N)C=1C2=C(C=CC1OCCCC)C=CC=C2.Cl

Synonyms:

• 1-Naphthalenemethanamine, 2-butoxy-, hydrochloride (1:1)