CAS 1201643-72-2
:4-(3-Acetyl-8-bromo-3H-pyrazolo[3,4-c]quinolin-1-yl)-α,α-dimethylbenzeneacetonitrile
Description:
4-(3-Acetyl-8-bromo-3H-pyrazolo[3,4-c]quinolin-1-yl)-α,α-dimethylbenzeneacetonitrile is a complex organic compound characterized by its unique structural features, which include a pyrazoloquinoline core and an acetonitrile functional group. The presence of the bromine atom introduces notable halogenation, which can influence the compound's reactivity and potential applications in medicinal chemistry. The acetyl group contributes to the compound's polarity and may enhance its solubility in organic solvents. Additionally, the α,α-dimethylbenzeneacetonitrile moiety suggests a bulky structure that could affect the compound's steric properties and interactions with biological targets. This compound may exhibit interesting pharmacological activities due to its diverse functional groups, making it a candidate for further research in drug development. Its specific properties, such as melting point, solubility, and spectral characteristics, would require empirical determination through experimental methods. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in various fields, including pharmaceuticals and materials science.
Formula:C22H17BrN4O
InChI:InChI=1S/C22H17BrN4O/c1-13(28)27-19-11-25-18-9-8-16(23)10-17(18)20(19)21(26-27)14-4-6-15(7-5-14)22(2,3)12-24/h4-11H,1-3H3
InChI key:InChIKey=RTUILLNUVFGQRW-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C2=C(C(=N1)C3=CC=C(C(C#N)(C)C)C=C3)C=4C(N=C2)=CC=C(Br)C4
Synonyms:- 2-[4-(3-Acetyl-8-bromopyrazolo[3,4-c]quinolin-1-yl)phenyl]-2-methylpropanenitrile
- 2-(4-(3-Acetyl-8-bromo-3H-pyrazolo[3,4-c]quinolin-1-yl)phenyl)-2-methylpropanenitrile
- Benzeneacetonitrile, 4-(3-acetyl-8-bromo-3H-pyrazolo[3,4-c]quinolin-1-yl)-α,α-dimethyl-
- 4-(3-Acetyl-8-bromo-3H-pyrazolo[3,4-c]quinolin-1-yl)-α,α-dimethylbenzeneacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.