CAS 1201643-90-4

B-[1-(1-Methylethyl)-1H-pyrazol-4-yl]boronic acid

Description:

B-[1-(1-Methylethyl)-1H-pyrazol-4-yl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a pyrazole ring. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and possessing moderate stability under standard conditions. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the isopropyl group on the pyrazole ring contributes to its lipophilicity, potentially influencing its biological activity and interaction with other molecules. Additionally, this compound may exhibit unique reactivity due to the electron-withdrawing nature of the boronic acid, which can affect its coordination with other ligands or substrates. Overall, B-[1-(1-Methylethyl)-1H-pyrazol-4-yl]boronic acid is a versatile compound with applications in synthetic chemistry and drug development.

Formula: C₆H₁₁BN₂O₂

InChI: InChI=1S/C6H11BN2O2/c1-5(2)9-4-6(3-8-9)7(10)11/h3-5,10-11H,1-2H3

InChI key: InChIKey=VLVZNLMUFJYZDG-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CN(C(C)C)N=C1

Synonyms:

• Boronic acid, B-[1-(1-methylethyl)-1H-pyrazol-4-yl]-
• (1-Isopropyl-1H-pyrazol-4-yl)boronic acid
• B-[1-(1-Methylethyl)-1H-pyrazol-4-yl]boronic acid
• (1-Isopropylpyrazol-4-yl)boronic acid
• 1-Isopropylpyrazole-4-boronic acid

Boronic acid, B-[1-(1-methylethyl)-1H-pyrazol-4-yl]-

CAS: 1201643-90-4

Formula: C₆H₁₁BN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.9747

Ref: IN-DA000QFO

1-Isopropylpyrazole-4-boronic acid

CAS: 1201643-90-4

1-Isopropylpyrazole-4-boronic acid

Purity: 97%

Molecular weight: 153.98g/mol

Ref: 54-OR360432

(1-Isopropyl-1H-pyrazol-4-yl)boronic acid

CAS: 1201643-90-4

Formula: C₆H₁₁BN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 153.98

Ref: 10-F217267