CymitQuimica logo

CAS 1201644-40-7

:

N-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanesulfonamide

Description:
N-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanesulfonamide is a chemical compound characterized by its unique structure, which includes a pyridine ring and a boron-containing moiety. The presence of the tetramethyl-1,3,2-dioxaborolane group suggests that it may exhibit properties related to boron chemistry, such as potential reactivity in organoboron chemistry and applications in medicinal chemistry. The methanesulfonamide functional group indicates that the compound may possess sulfonamide characteristics, which can influence its solubility and biological activity. This compound may be of interest in pharmaceutical research due to its potential as a building block in drug development or as a tool in chemical biology. Its specific interactions, stability, and reactivity would depend on the surrounding conditions, such as pH and solvent, making it a candidate for further investigation in various chemical and biological contexts. Overall, this compound exemplifies the intersection of organic chemistry and medicinal applications, highlighting the importance of functional group diversity in compound design.
Formula:C12H19BN2O4S
InChI:InChI=1S/C12H19BN2O4S/c1-11(2)12(3,4)19-13(18-11)9-6-7-10(14-8-9)15-20(5,16)17/h6-8H,1-5H3,(H,14,15)
InChI key:InChIKey=NTQPIFIUWHDOPF-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=CC(NS(C)(=O)=O)=NC2
Synonyms:
  • N-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanesulfonamide
  • Methanesulfonamide, N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.