CymitQuimica logo

CAS 1201644-43-0

:

N-(Phenylmethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide

Description:
N-(Phenylmethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carboxamide functional group, and a boron-containing moiety. The presence of the tetramethyl-1,3,2-dioxaborolane group suggests that this compound may exhibit unique reactivity, particularly in organoboron chemistry, where boron can participate in various reactions such as Suzuki coupling. The phenylmethyl substituent adds hydrophobic characteristics, potentially influencing the compound's solubility and interaction with biological systems. This compound may be of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its molecular structure indicates that it could engage in hydrogen bonding and π-π stacking interactions, which are significant in biological and chemical processes. Overall, the compound's unique features make it a candidate for further investigation in both synthetic and applied chemistry contexts.
Formula:C19H23BN2O3
InChI:InChI=1S/C19H23BN2O3/c1-18(2)19(3,4)25-20(24-18)15-10-11-16(21-13-15)17(23)22-12-14-8-6-5-7-9-14/h5-11,13H,12H2,1-4H3,(H,22,23)
InChI key:InChIKey=VQMJENZEDUSFPG-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=CC(C(NCC3=CC=CC=C3)=O)=NC2
Synonyms:
  • N-(Phenylmethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide
  • 2-Pyridinecarboxamide, N-(phenylmethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.